A4921012
8-Hydroxyquinoline-5-sulfonic Acid , 97% , 84-88-8
CAS NO.:84-88-8
Empirical Formula: C9H7NO4S
Molecular Weight: 225.22
MDL number: MFCD00006795
EINECS: 201-570-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB111.20 | In Stock |
|
| 100G | RMB372.00 | In Stock |
|
| 25G | RMB463.20 | In Stock |
|
| 500g | RMB2920.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 311-313°C |
| Density | 1.4899 (rough estimate) |
| refractive index | 1.5364 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | crystalline |
| pka | pK1:4.092(+1);pK2:8.776(0) (25°C) |
| color | yellow to green |
| Merck | 4844 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H7NO4S/c11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7/h1-5,11H,(H,12,13,14) |
| InChIKey | LGDFHDKSYGVKDC-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(S(O)(=O)=O)C=CC=2O)C=CC=1 |
| CAS DataBase Reference | 84-88-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Quinolinesulfonic acid, 8-hydroxy-(84-88-8) |
| EPA Substance Registry System | 5-Quinolinesulfonic acid, 8-hydroxy- (84-88-8) |
Description and Uses
8-Hydroxy-5-quinolinesulfonic acid is used in the synthesis of fat mass and obesity associated proteins. Also used in the synthesis of anti-schitosomal compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P201-P280-P305+P351+P338-P308+P313-P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | VC2570000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29334990 |





