A4973612
Imazapyr , Analysis standard product, 99.5% , 81334-34-1
CAS NO.：81334-34-1
Empirical Formula: C13H15N3O3
Molecular Weight: 261.28
MDL number: MFCD00144470
EINECS: 200-158-5
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-173°C |
| Boiling point: | 404.53°C (rough estimate) |
| Density | 1.1923 (rough estimate) |
| vapor pressure | 0-0Pa at 20-25℃ |
| refractive index | 1.5600 (estimate) |
| storage temp. | 0-6°C |
| pka | 1.9, 3.6(at 25℃) |
| BRN | 5442754 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19) |
| InChIKey | CLQMBPJKHLGMQK-UHFFFAOYSA-N |
| SMILES | C1(C2NC(=O)C(C)(C(C)C)N=2)=NC=CC=C1C(O)=O |
| LogP | -3.97-0.04 at 20℃ and pH3-9.9 |
| Dissociation constant | 1.7-11.1 at 20℃ |
| CAS DataBase Reference | 81334-34-1(CAS DataBase Reference) |
| EPA Substance Registry System | Imazapyr (81334-34-1) |
Description and Uses
Imazapyr is an analytical standard used for proteomics research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36-52/53 |
| Safety Statements | 26-61 |
| WGK Germany | 2 |
| RTECS | US5682500 |
| HS Code | 29333990 |
| Hazardous Substances Data | 81334-34-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >5000 mg/kg; dermally in rabbits: >2000 mg/kg (Paxman) |
