A4975112
N-Isopropylaniline , 99% , 768-52-5
CAS NO.:768-52-5
Empirical Formula: C9H13N
Molecular Weight: 135.21
MDL number: MFCD00026347
EINECS: 212-196-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25g | RMB38.40 | In Stock |
|
| 100G | RMB88.80 | In Stock |
|
| 500g | RMB342.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -32°C |
| Boiling point: | 55 °C0.3 mm Hg(lit.) |
| Density | 0.934 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 5.77(at 25℃) |
| Specific Gravity | 0.94 |
| color | Colorless to Orange to Green |
| Water Solubility | <0.01 g/100 mL at 21 ºC |
| BRN | 2205871 |
| Exposure limits | ACGIH: TWA 2 ppm (Skin) NIOSH: IDLH 100 ppm; TWA 2 ppm(10 mg/m3) |
| CAS DataBase Reference | 768-52-5(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Isopropylaniline(768-52-5) |
| EPA Substance Registry System | N-Isopropylaniline (768-52-5) |
Description and Uses
Dyeing of acrylic fibers and as a chemical intermediate
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H330-H335-H227-H331 |
| Precautionary statements | P210e-P261-P280a-P304+P340-P405-P501a-P260-P284-P305+P351+P338-P310 |
| Hazard Codes | T |
| Risk Statements | 22-23-36/37/38 |
| Safety Statements | 26-36-45-7/9 |
| RIDADR | 2810 |
| OEB | B |
| OEL | TWA: 2 ppm (10 mg/m3) [skin] |
| WGK Germany | 3 |
| RTECS | BY4190000 |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214990 |
| Hazardous Substances Data | 768-52-5(Hazardous Substances Data) |






