A4975412
Methyl 4-Iodobenzoate , 98% , 619-44-3
Synonym(s):
4-Iodobenzoic acid methyl ester
CAS NO.:619-44-3
Empirical Formula: C8H7IO2
Molecular Weight: 262.04
MDL number: MFCD00016353
EINECS: 210-597-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 10g | RMB59.20 | In Stock |
|
| 25G | RMB70.40 | In Stock |
|
| 50g | RMB119.20 | In Stock |
|
| 100G | RMB272.00 | In Stock |
|
| 250g | RMB503.20 | In Stock |
|
| 500g | RMB999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-116 °C |
| Boiling point: | 278.5°C (rough estimate) |
| Density | 2.0200 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Beige to pale pink |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C8H7IO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5H,1H3 |
| InChIKey | DYUWQWMXZHDZOR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(I)C=C1 |
| CAS DataBase Reference | 619-44-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-iodo-, methyl ester(619-44-3) |
| EPA Substance Registry System | Benzoic acid, 4-iodo-, methyl ester (619-44-3) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-51/53 |
| Safety Statements | 37/39-26-61 |
| RIDADR | UN 3082 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |




