A4979612
3-Iodobenzonitrile , 99% , 69113-59-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 10g | RMB119.20 | In Stock |
|
| 25G | RMB199.20 | In Stock |
|
| 50g | RMB367.20 | In Stock |
|
| 100g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-43 °C(lit.) |
| Boiling point: | 260.1±23.0 °C(Predicted) |
| Density | 1.91±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Dark green |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H4IN/c8-7-3-1-2-6(4-7)5-9/h1-4H |
| InChIKey | BGARPMGQRREXLN-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(I)=C1 |
| CAS DataBase Reference | 69113-59-3(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-37/39-24/25 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
