A4991912
3-Iodo-L-tyrosine , 98% , 70-78-0
Synonym(s):
3-Monoiodo-L -tyrosine
CAS NO.:70-78-0
Empirical Formula: C9H10INO3
Molecular Weight: 307.09
MDL number: MFCD00002608
EINECS: 200-744-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB1077.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C (dec.)(lit.) |
| Density | 1.7280 (estimate) |
| storage temp. | -20°C |
| solubility | dilute aqueous acid: soluble |
| Boiling point: | 391.0±42.0 °C(Predicted) |
| pka | 2.21±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| Sensitive | Light Sensitive |
| Merck | 14,5047 |
| BRN | 2941266 |
| Stability: | Hygroscopic |
| InChI | 1S/C9H10INO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | UQTZMGFTRHFAAM-ZETCQYMHSA-N |
| SMILES | N[C@@H](Cc1ccc(O)c(I)c1)C(O)=O |
| CAS DataBase Reference | 70-78-0(CAS DataBase Reference) |
| EPA Substance Registry System | L-Tyrosine, 3-iodo- (70-78-0) |
Description and Uses
3-Iodo-L-tyrosine has been used as an inhibitor for tyrosine hydroxylase enzyme in Drosophila and silkworm pupae.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |






