A4992512
Isonicotinoyl chloride hydrochloride , 95% , 39178-35-3
CAS NO.:39178-35-3
Empirical Formula: C6H5Cl2NO
Molecular Weight: 178.02
MDL number: MFCD00012830
EINECS: 254-331-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 10g | RMB87.20 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 50g | RMB247.20 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| 250g | RMB1183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | methanol: soluble50mg/mL, clear to hazy, colorless to light yellow |
| form | Crystalline Powder |
| color | Almost white to beige |
| Water Solubility | almost transparency |
| Sensitive | Moisture Sensitive |
| BRN | 3626052 |
| InChI | InChI=1S/C6H4ClNO.ClH/c7-6(9)5-1-3-8-4-2-5;/h1-4H;1H |
| InChIKey | BNTRVUUJBGBGLZ-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)=O)=CC=NC=C1.Cl |
| CAS DataBase Reference | 39178-35-3(CAS DataBase Reference) |
Description and Uses
Isonicotinoyl chloride hydrochloride was used in the synthesis of 7,16-diisonicotinoyltetraaza[14]annulene.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29333990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






