A4993612
3-Indolybutyric acid , Analysis standard product, 99.5% , 133-32-4
Synonym(s):
4-(3-Indolyl)butanoic acid;4-(3-Indolyl)butyric acid;IBA
CAS NO.:133-32-4
Empirical Formula: C12H13NO2
Molecular Weight: 203.24
MDL number: MFCD00005664
EINECS: 205-101-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB318.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-125.5 °C(lit.) |
| Boiling point: | 341.55°C (rough estimate) |
| Density | 1.1255 (rough estimate) |
| bulk density | 360kg/m3 |
| refractive index | 1.5440 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF: 25 mg/mL; DMSO: 25 mg/mL; Ethanol: 25 mg/mL; PBS (pH 7.2): 0.1 mg/mL |
| pka | 4.83±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | Soluble in water(0.25g/L). |
| Sensitive | Air Sensitive |
| Merck | 14,4965 |
| BRN | 171120 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Light sensitive. |
| InChI | 1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15) |
| InChIKey | JTEDVYBZBROSJT-UHFFFAOYSA-N |
| SMILES | OC(=O)CCCc1c[nH]c2ccccc12 |
| LogP | 2.300 |
| CAS DataBase Reference | 133-32-4(CAS DataBase Reference) |
| EPA Substance Registry System | Indole-3-butyric acid (133-32-4) |
Description and Uses
Indole-3-butyric acid is auxin-family plant hormone (phytohormone). IBA is thought to be a precursor of indole-3-acetic acid (IAA) the most abundant and the basic auxin natively occurring and functioning in plants. IAA generates the majority of auxin effects in intact plants, and is the most potent native auxin.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36-45-38-36/37/39-28A |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NL5250000 |
| F | 8-10-23 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Hazardous Substances Data | 133-32-4(Hazardous Substances Data) |
| Toxicity | LD50 i.p. in mice: 100 mg/kg (Anderson) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




