A4997112
D-(-)-Isoascorbic acid , Analysis standard , 89-65-6
Synonym(s):
Erythorbic acid;Glucosaccharonic acid;D- (?)-Isoascorbic acid;D -(?)-Isoascorbic acid;D -erythro-Hex-2-enoic acid γ-lactone
CAS NO.:89-65-6
Empirical Formula: C6H8O6
Molecular Weight: 176.12
MDL number: MFCD00005378
EINECS: 201-928-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB313.60 | In Stock |
|
| 500mg | RMB559.20 | In Stock |
|
| 1g | RMB999.20 | In Stock |
|
| 5g | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-172 °C (dec.) (lit.) |
| alpha | -17.25 º (c=10, H2O 25 ºC) |
| Boiling point: | 227.71°C (rough estimate) |
| Density | 1.3744 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| FEMA | 2410 | ERYTHROBIC ACID |
| refractive index | -17.5 ° (C=10, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless to very faintly yellow |
| pka | 4.09±0.10(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to slightly yellow |
| Odor | odorless |
| biological source | (Starch) |
| optical activity | [α]25/D 16.8°, c = 2 in H2O |
| Water Solubility | 1g/10mL |
| Merck | 14,5126 |
| BRN | 84271 |
| Stability: | Stable. Combustible. Incompatible with chemically active metals, aluminium, zinc, copper, magnesium, strong bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| Cosmetic Ingredient Review (CIR) | Erythorbic Acid (89-65-6) |
| InChI | 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5-/m1/s1 |
| InChIKey | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| SMILES | [H][C@@]1(OC(=O)C(O)=C1O)[C@H](O)CO |
| LogP | -1.69 at 25℃ |
| CAS DataBase Reference | 89-65-6(CAS DataBase Reference) |
| EPA Substance Registry System | Isoascorbic acid (89-65-6) |
Description and Uses
Antioxidant (industrial and food), especially in brewing industry, reducing agent in photography.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-24/25 |
| WGK Germany | 2 |
| RTECS | KF3015000 |
| TSCA | TSCA listed |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 89-65-6(Hazardous Substances Data) |




