A4999412
3-Indoleacrylic acid , 98% , 1204-06-4
Synonym(s):
3-(3-Indolyl)acrylic acid;IAA
CAS NO.:1204-06-4
Empirical Formula: C11H9NO2
Molecular Weight: 187.19
MDL number: MFCD00005633
EINECS: 214-872-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB192.80 | In Stock |
|
| 25g | RMB795.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185 °C (dec.)(lit.) |
| Boiling point: | 321.94°C (rough estimate) |
| Density | 1.1963 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | room temp |
| form | powder |
| pka | 4.59±0.10(Predicted) |
| color | white to light yellow |
| Water Solubility | freely soluble |
| BRN | 6317 |
| InChI | InChI=1S/C11H9NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-7,12H,(H,13,14) |
| InChIKey | PLVPPLCLBIEYEA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1C2=C(NC=1)C=CC=C2 |
| CAS DataBase Reference | 1204-06-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(1H-indol-3-yl)- (1204-06-4) |
Description and Uses
3-Indoleacrylic acid has been used in the induction of ribokinase expression in E. coli.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | NL3680000 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |






