A5005312
D-allo-Isoleucine , 98% , 1509-35-9
Synonym(s):
(2R,3S)-2-Amino-3-methylpentanoic acid
CAS NO.:1509-35-9
Empirical Formula: C6H13NO2
Molecular Weight: 131.17
MDL number: MFCD00066445
EINECS: 216-143-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB236.00 | In Stock |
|
| 10g | RMB473.20 | In Stock |
|
| 25G | RMB1026.40 | In Stock |
|
| 100g | RMB3949.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 291 °C (dec.)(lit.) |
| alpha | -38 º (in 6N HCl) |
| Boiling point: | 225.8±23.0 °C(Predicted) |
| Density | 1.1720 (estimate) |
| refractive index | -37 ° (C=4, 6mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Water (Slightly) |
| pka | 2.57±0.24(Predicted) |
| form | Crystalline Powder |
| color | White |
| optical activity | [α]20/D 38° in 6 M HCl |
| BRN | 1721794 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5+/m0/s1 |
| InChIKey | AGPKZVBTJJNPAG-CRCLSJGQSA-N |
| SMILES | C(O)(=O)[C@@H]([C@@H](C)CC)N |
| CAS DataBase Reference | 1509-35-9(CAS DataBase Reference) |
Description and Uses
D-allo-Isoleucine is used in the synthesis of a conjugate of epi-jasmonic acid and various antimicrobial peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | BA2930000 |
| HS Code | 29224999 |
| Storage Class | 13 - Non Combustible Solids |





