A5008312
Isoferulic Acid , Analysis of standard products, ≥98% , 537-73-5
CAS NO.:537-73-5
Empirical Formula: C10H10O4
Molecular Weight: 194.18
MDL number: MFCD00004391
EINECS: 208-676-0
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB86.40 | In Stock |
|
| 10MG | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C (dec.)(lit.) |
| Boiling point: | 250.62°C (rough estimate) |
| Density | 1.0583 (rough estimate) |
| refractive index | 1.5168 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in ethanol and methanol. |
| form | Solid |
| pka | 4.53±0.10(Predicted) |
| color | Pale Yellow |
| BRN | 2212760 |
| InChI | InChI=1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13) |
| InChIKey | QURCVMIEKCOAJU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C(O)=C1 |
| LogP | 0.788 (est) |
| CAS DataBase Reference | 537-73-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Cinnamic acid, 3-hydroxy-4-methoxy-(537-73-5) |
Description and Uses
3-Hydroxy-4-methoxycinnamic acid was used in the synthesis of tranilast and various tranilast analogs (cinnamoyl anthranilates) by genetically engineered Saccharomyces cerevisiae yeast strain. It was also used in the synthesis of glycoside compounds by undergoing glycosidation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 2 |
| RTECS | UD3365400 |
| Hazard Note | Irritant |
| HS Code | 29189090 |






