A5010612
L-Isoleucinol , 97% , 24629-25-2
Synonym(s):
(2S,3S)-2-Amino-3-methyl-1-pentanol;L -Isoleucinol
CAS NO.：24629-25-2
Empirical Formula: C6H15NO
Molecular Weight: 117.19
MDL number: MFCD00004731
EINECS: 246-371-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB247.20 | In Stock |
|
| 100g | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-39 °C(lit.) |
| Boiling point: | 97 °C14 mm Hg(lit.) |
| alpha | 4.5 º (c=1.6, EtOH) |
| Density | 0.9490 (rough estimate) |
| refractive index | n |
| Flash point: | 213 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 12.88±0.10(Predicted) |
| form | Viscous Liquid |
| color | White to light yellow |
| optical activity | [α]20/D +4.0°, c = 1.6 in ethanol |
| InChI | InChI=1S/C6H15NO/c1-3-5(2)6(7)4-8/h5-6,8H,3-4,7H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | VTQHAQXFSHDMHT-NTSWFWBYSA-N |
| SMILES | C(O)[C@@H](N)[C@@H](C)CC |
| CAS DataBase Reference | 24629-25-2(CAS DataBase Reference) |
| NIST Chemistry Reference | (S)-(+)-Isoleucinol(24629-25-2) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 34-22-40 |
| Safety Statements | 45-36/37/39-26-36-22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29221990 |
