A5014512
Isocarbostyril , 98% , 491-30-5
Synonym(s):
1(2H)-Isoquinolinone;1-Hydroxyisoquinoline;1-Isoquinolinol
CAS NO.：491-30-5
Empirical Formula: C9H7NO
Molecular Weight: 145.16
MDL number: MFCD00006899
EINECS: 207-732-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB226.40 | In Stock |
|
| 10G | RMB441.60 | In Stock |
|
| 25g | RMB704.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212-216 °C |
| Boiling point: | 376.3±35.0 °C(Predicted) |
| Density | 1.188±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| pka | 13.62±0.20(Predicted) |
| form | Powder or Crystalline Powder |
| color | White to pale brown |
| BRN | 2954 |
| InChI | InChI=1S/C9H7NO/c11-9-8-4-2-1-3-7(8)5-6-10-9/h1-6H,(H,10,11) |
| InChIKey | VDBNYAPERZTOOF-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C=CN1 |
| CAS DataBase Reference | 491-30-5(CAS DataBase Reference) |
Description and Uses
1-Hydroxyisoquinoline (cas# 491-30-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37-26 |
| WGK Germany | 3 |
| TSCA | N |
| HS Code | 29334900 |
