A5015812
Isooctyl 3-mercaptopropionate , 99% , 30374-01-7
Synonym(s):
Isooctyl β-mercaptopropionate;Isooctyl mercaptopropionate
CAS NO.:30374-01-7
Empirical Formula: C11H22O2S
Molecular Weight: 218.36
MDL number: MFCD00046846
EINECS: 250-157-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB116.00 | In Stock |
|
| 100G | RMB303.20 | In Stock |
|
| 500G | RMB952.00 | In Stock |
|
| 5KG | RMB5584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 109-112 °C2 mm Hg(lit.) |
| Density | 0.950 g/mL at 25 °C(lit.) |
| vapor pressure | 0.28-0.45Pa at 20-25℃ |
| refractive index | n |
| Flash point: | 14 °F |
| storage temp. | 2-8°C(protect from light) |
| form | Liquid |
| InChI | InChI=1S/C11H22O2S/c1-10(2)6-4-3-5-8-13-11(12)7-9-14/h10,14H,3-9H2,1-2H3 |
| InChIKey | ZHUWXKIPGGZNJW-UHFFFAOYSA-N |
| SMILES | O(C(=O)CCS)CCCCCC(C)C |
| LogP | 4.62-5.33 at 30℃ and pH6.3 |
| EPA Substance Registry System | Propanoic acid, 3-mercapto-, isooctyl ester (30374-01-7) |
Description and Uses
Polymerization modifier: crosslinking agent, chain transfer agent
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H302-H317-H410 |
| Precautionary statements | P210-P233-P273-P280-P301+P312-P303+P361+P353 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33-7/9 |
| RIDADR | UN 1993 3/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Flam. Liq. 2 Skin Sens. 1 |








