A5016012
(R)-(-)-3-Isopropyl-2,5-piperazinedione , 97% , 143673-66-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB199.20 | In Stock |
|
| 5G | RMB687.20 | In Stock |
|
| 25g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 258-262 °C(lit.) |
| alpha | -31.5 º (c=1, water) |
| Boiling point: | 280.42°C (rough estimate) |
| Density | 1.1832 (rough estimate) |
| refractive index | 1.4880 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 13.12±0.40(Predicted) |
| optical activity | [α]20/D 31.5°, c = 1 in H2O |
| Water Solubility | 23 g/L (22 ºC) |
| BRN | 82869 |
| InChI | InChI=1S/C7H12N2O2/c1-4(2)6-7(11)8-3-5(10)9-6/h4,6H,3H2,1-2H3,(H,8,11)(H,9,10)/t6-/m1/s1 |
| InChIKey | IULFBTHVPRNQCG-ZCFIWIBFSA-N |
| SMILES | N1CC(=O)N[C@H](C(C)C)C1=O |
Description and Uses
Chiral auxiliary developed by Professor Schllkopf for the enantioselective synthesis of α-amino acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29335995 |
| Storage Class | 11 - Combustible Solids |





![(<I>R</I>)-(−)-α-[[(4-Ethyl-2,3-dioxo-1-piperazinyl)
carbonyl]amino]-4-hydroxybenzeneacetic acid](https://img.chemicalbook.com/CAS/GIF/62893-24-7.gif)
