A5016412
2-Iodo-3-hydroxypyridine , 98% , 40263-57-8
Synonym(s):
2-Iodo-3-pyridinol
CAS NO.：40263-57-8
Empirical Formula: C5H4INO
Molecular Weight: 221
MDL number: MFCD00023421
EINECS: 254-864-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB133.60 | In Stock |
|
| 25G | RMB442.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195°C |
| Boiling point: | 296.6±20.0 °C(Predicted) |
| Density | 2.142±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 4.74±0.10(Predicted) |
| color | White to tan |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive |
| BRN | 109836 |
| InChI | InChI=1S/C5H4INO/c6-5-4(8)2-1-3-7-5/h1-3,8H |
| InChIKey | HJBGMPCMSWJZNH-UHFFFAOYSA-N |
| SMILES | C1(I)=NC=CC=C1O |
| CAS DataBase Reference | 40263-57-8(CAS DataBase Reference) |
Description and Uses
2-Iodo-3-hydroxypyridine acts as a reagent in the synthesis of the differentiating antibiotic azatyrosine
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
