A5018512
(S)-(+)-4-Isopropyl-3-propionyl-2-oxazolidinone , 98% , 77877-19-1
Synonym(s):
(S)-3-Propionyl-4-isopropyl-2-oxazolidinone
| Pack Size | Price | Stock | Quantity |
| 1G | RMB412.80 | In Stock |
|
| 5G | RMB1345.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 93 º (c=8.7 in methylene chloride) |
| Boiling point: | 102-106 °C0.75 mm Hg(lit.) |
| Density | 1.094 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| optical activity | [α]25/D +93°, c = 8.7 in methylene chloride |
| BRN | 3542849 |
| InChI | 1S/C9H15NO3/c1-4-8(11)10-7(6(2)3)5-13-9(10)12/h6-7H,4-5H2,1-3H3/t7-/m1/s1 |
| InChIKey | HOWPHXVPNNPSAZ-SSDOTTSWSA-N |
| SMILES | CCC(=O)N1[C@H](COC1=O)C(C)C |
| CAS DataBase Reference | 77877-19-1(CAS DataBase Reference) |
Description and Uses
(S)-(+)-4-Isopropyl-3-propionyl-2-oxazolidinone is used as a reactant in the preparation of oxazolidinone derivatives as IL-6 signaling blockers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |






