A5021612
2-Iodo-4-(trifluoromethyl)aniline , 98% , 163444-17-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB149.60 | In Stock |
|
| 100G | RMB567.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50 °C |
| Boiling point: | 252.8±40.0 °C(Predicted) |
| Density | 1.948±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 0.70±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C7H5F3IN/c8-7(9,10)4-1-2-6(12)5(11)3-4/h1-3H,12H2 |
| InChIKey | UKKWTZPXYIYONW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C(F)(F)F)C=C1I |
| CAS DataBase Reference | 163444-17-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H301-H311-H332-H335 |
| Precautionary statements | P301+P310a-P305+P351+P338-P405-P501a-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | UN2811 |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
