A5023112
Isochroman , 98% , 493-05-0
CAS NO.:493-05-0
Empirical Formula: C9H10O
Molecular Weight: 134.18
MDL number: MFCD00006913
EINECS: 207-774-0
| Pack Size | Price | Stock | Quantity |
| 10G | RMB39.20 | In Stock |
|
| 50G | RMB159.20 | In Stock |
|
| 100G | RMB260.00 | In Stock |
|
| 500G | RMB1080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 4.35°C |
| Boiling point: | 75 °C (3.0004 mmHg) |
| Density | 1.067 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C9H10O/c1-2-4-9-7-10-6-5-8(9)3-1/h1-4H,5-7H2 |
| InChIKey | HEBMCVBCEDMUOF-UHFFFAOYSA-N |
| SMILES | C1OCC2=CC=CC=C2C1 |
| CAS DataBase Reference | 493-05-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Isochroman(493-05-0) |
Description and Uses
Isochroman is a mycotoxins that inhibits the growth of Bacillus thuringiensis and causes morphological abnormalities in the cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P501a-P210-P280-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29329990 |
| Storage Class | 10 - Combustible liquids |




