A5024712
                    Ifosfamide , Medicinal grade , 3778-73-2
                            Synonym(s):
Ifex;Ifosfamide;N,3-Bis(2-chloroethyl)tetrahydro-2H-1,3,2-oxazaphosphorin-2-amine-2-oxide
                            
                        
                CAS NO.:3778-73-2
Empirical Formula: C7H15Cl2N2O2P
Molecular Weight: 261.09
MDL number: MFCD00057374
EINECS: 223-237-3
| Pack Size | Price | Stock | Quantity | 
| 50MG | RMB55.20 | In Stock | 
                                                 | 
                                        
| 250mg | RMB103.20 | In Stock | 
                                                 | 
                                        
| 1g | RMB255.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB775.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 48°C | 
                                    
| Boiling point: | 336.1±52.0 °C(Predicted) | 
                                    
| Density | 1.33±0.1 g/cm3(Predicted) | 
                                    
| storage temp. | Inert atmosphere,2-8°C | 
                                    
| solubility | DMF:50.0(Max Conc. mg/mL);191.51(Max Conc. mM) DMSO:44.0(Max Conc. mg/mL);168.53(Max Conc. mM) Ethanol:51.0(Max Conc. mg/mL);195.34(Max Conc. mM) PBS (pH 7.2):10.0(Max Conc. mg/mL);38.3(Max Conc. mM) Water:52.0(Max Conc. mg/mL);199.17(Max Conc. mM)  | 
                                    
| pka | 1.44±0.20(Predicted) | 
                                    
| form | Solid | 
                                    
| color | White to off-white | 
                                    
| InChI | InChI=1S/C7H15Cl2N2O2P/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-7H2,(H,10,12) | 
                                    
| InChIKey | HOMGKSMUEGBAAB-UHFFFAOYSA-N | 
                                    
| SMILES | O1CCCN(CCCl)P1(=O)NCCCl | 
                                    
| CAS DataBase Reference | 3778-73-2(CAS DataBase Reference) | 
                                    
| IARC | 3 (Vol. 26, Sup 7) 1987 | 
                                    
| EPA Substance Registry System | Isophosphamide (3778-73-2) | 
                                    
Description and Uses
Ifosphamide USP (Ifex)is used to treat germ cell testicular cancer; used in combination with mesna.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08  | 
                                    
| Signal word | Danger | 
| Hazard statements | H301-H319-H340-H350-H360 | 
| Precautionary statements | P201-P301+P310+P330-P305+P351+P338 | 
| Hazard Codes | T | 
| Risk Statements | 25-36 | 
| Safety Statements | 26-45 | 
| RIDADR | 3249 | 
| WGK Germany | 3 | 
| RTECS | RP6050000 | 
| HazardClass | 6.1(b) | 
| PackingGroup | III | 
| HS Code | 29349990 | 
| Hazardous Substances Data | 3778-73-2(Hazardous Substances Data) | 
| Toxicity | LD50 in rats (mg/kg): 160 i.p. (Arnold, 1973); also reported as 150 i.p. (Brock) | 








