A5024712
Ifosfamide , Medicinal grade , 3778-73-2
Synonym(s):
Ifex;Ifosfamide;N,3-Bis(2-chloroethyl)tetrahydro-2H-1,3,2-oxazaphosphorin-2-amine-2-oxide
CAS NO.:3778-73-2
Empirical Formula: C7H15Cl2N2O2P
Molecular Weight: 261.09
MDL number: MFCD00057374
EINECS: 223-237-3
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB55.20 | In Stock |
|
| 250mg | RMB103.20 | In Stock |
|
| 1g | RMB255.20 | In Stock |
|
| 5g | RMB775.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48°C |
| Boiling point: | 336.1±52.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMF:50.0(Max Conc. mg/mL);191.51(Max Conc. mM) DMSO:44.0(Max Conc. mg/mL);168.53(Max Conc. mM) Ethanol:51.0(Max Conc. mg/mL);195.34(Max Conc. mM) PBS (pH 7.2):10.0(Max Conc. mg/mL);38.3(Max Conc. mM) Water:52.0(Max Conc. mg/mL);199.17(Max Conc. mM) |
| pka | 1.44±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C7H15Cl2N2O2P/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-7H2,(H,10,12) |
| InChIKey | HOMGKSMUEGBAAB-UHFFFAOYSA-N |
| SMILES | O1CCCN(CCCl)P1(=O)NCCCl |
| CAS DataBase Reference | 3778-73-2(CAS DataBase Reference) |
| IARC | 3 (Vol. 26, Sup 7) 1987 |
| EPA Substance Registry System | Isophosphamide (3778-73-2) |
Description and Uses
Ifosphamide USP (Ifex)is used to treat germ cell testicular cancer; used in combination with mesna.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H319-H340-H350-H360 |
| Precautionary statements | P201-P301+P310+P330-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-36 |
| Safety Statements | 26-45 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | RP6050000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 1B Eye Irrit. 2 Muta. 1B Repr. 1B |
| Hazardous Substances Data | 3778-73-2(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): 160 i.p. (Arnold, 1973); also reported as 150 i.p. (Brock) |








