A5033312
5-Iodouracil , 99% , 696-07-1
Synonym(s):
2,4-Dihydroxy-5-iodopyrimidine
CAS NO.:696-07-1
Empirical Formula: C4H3IN2O2
Molecular Weight: 237.98
MDL number: MFCD00006020
EINECS: 211-788-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 10G | RMB85.60 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 50G | RMB373.60 | In Stock |
|
| 100G | RMB387.20 | In Stock |
|
| 250G | RMB1730.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 274-276 °C (dec.) (lit.) |
| Density | 2.2076 (estimate) |
| storage temp. | 2-8°C |
| solubility | Very faint turbidity in NH3aq. Soluble in 1M NaOH. |
| pka | 7.02±0.10(Predicted) |
| form | Fluffy Powder |
| color | White to light yellow |
| Water Solubility | SOLUBLE IN COLD WATER |
| Sensitive | Light Sensitive |
| BRN | 4891 |
| InChI | InChI=1S/C4H3IN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | KSNXJLQDQOIRIP-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(I)C(=O)N1 |
| CAS DataBase Reference | 696-07-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Iodouracil(696-07-1) |
| EPA Substance Registry System | 2,4(1H,3H)-Pyrimidinedione, 5-iodo- (696-07-1) |
Description and Uses
5-Iodouracil is a halogenated pyrimidine that can be used in nucleoprotein photo-crosslinking via RNA substitution. 5-Iodouracil is used in thymidine phosphorylase targeted imaging and therapy. Studies show that DNA N-glycosylase MED1 exhibited higher preference for 5-Iodouracil and halogenated bases over non-halogenated ones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 46-20/21/22-36/37/38 |
| Safety Statements | 53-22-26-36/37/39-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | YR0525000 |
| Hazard Note | Irritant/Carcinogenic/Light Sensitive |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






