A5034812
Indole-6-carboxylic Acid Methyl Ester , ≥98.0% , 50820-65-0
Synonym(s):
Indole-6-carboxylic acid methyl ester
CAS NO.:50820-65-0
Empirical Formula: C10H9NO2
Molecular Weight: 175.18
MDL number: MFCD00211063
EINECS: 610-576-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-80 °C (lit.) |
| Boiling point: | 331.7±15.0 °C(Predicted) |
| Density | 1.253±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Powder or Crystalline Powder |
| pka | 15.80±0.30(Predicted) |
| color | White to pale brown |
| BRN | 141837 |
| InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-3-2-7-4-5-11-9(7)6-8/h2-6,11H,1H3 |
| InChIKey | AYYOZKHMSABVRP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(OC)=O)=C2)C=C1 |
| CAS DataBase Reference | 50820-65-0(CAS DataBase Reference) |
Description and Uses
An indole compound for treating pain, inflammation and other conditions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



