A5036112
Isobavachalcone , ≥98% , 20784-50-3
Synonym(s):
(2E)-1-[2,4-Dihydroxy-3-(3-methyl-2-butenyl)phenyl]-3-(4-hydroxyphenyl)-2-propen-1-one;2′,4,4′-Trihydroxy-3′-(3-methyl-2-butenyl)-chalcone;Corylifolinin;Isobacachalcone
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB167.20 | In Stock |
|
| 20MG | RMB286.40 | In Stock |
|
| 25MG | RMB1599.20 | In Stock |
|
| 50mg | RMB2399.20 | In Stock |
|
| 100MG | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156.8-157.8 °C(Solv: ethyl acetate (141-78-6); hexane (110-54-3)) |
| Boiling point: | 549.0±50.0 °C(Predicted) |
| Density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in DMSO |
| pka | 7.99±0.40(Predicted) |
| form | Yellow oil. |
| color | Yellow-orange |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C20H20O4/c1-13(2)3-9-16-19(23)12-10-17(20(16)24)18(22)11-6-14-4-7-15(21)8-5-14/h3-8,10-12,21,23-24H,9H2,1-2H3/b11-6+ |
| InChIKey | DUWPGRAKHMEPCM-IZZDOVSWSA-N |
| SMILES | C(C1=CC=C(O)C(C/C=C(/C)\C)=C1O)(=O)/C=C/C1=CC=C(O)C=C1 |
Description and Uses
Isobavachalcone is an inhibitor of platelet aggregation.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P501-P270-P264-P301+P310+P330-P405 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |







