PRODUCT Properties
| Melting point: | 230 °C (dec.)(lit.) |
| Boiling point: | 250.62°C (rough estimate) |
| Density | 1.0583 (rough estimate) |
| refractive index | 1.5168 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in ethanol and methanol. |
| pka | 4.53±0.10(Predicted) |
| form | Solid |
| color | Pale Yellow |
| BRN | 2212760 |
| InChI | InChI=1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13) |
| InChIKey | QURCVMIEKCOAJU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C(O)=C1 |
| LogP | 0.788 (est) |
| CAS DataBase Reference | 537-73-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Cinnamic acid, 3-hydroxy-4-methoxy-(537-73-5) |
Description and Uses
3-Hydroxy-4-methoxycinnamic acid was used in the synthesis of tranilast and various tranilast analogs (cinnamoyl anthranilates) by genetically engineered Saccharomyces cerevisiae yeast strain. It was also used in the synthesis of glycoside compounds by undergoing glycosidation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 2 |
| RTECS | UD3365400 |
| Hazard Note | Irritant |
| HS Code | 29189090 |
| Storage Class | 11 - Combustible Solids |






