A5043012
Itaconic Anhydride , ≥95.0% , 2170-03-8
Synonym(s):
2-Methylenesuccinic anhydride;Itaconic anhydride
CAS NO.:2170-03-8
Empirical Formula: C5H4O3
Molecular Weight: 112.08
MDL number: MFCD00005530
EINECS: 218-518-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB126.40 | In Stock |
|
| 500G | RMB519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68 °C (lit.) |
| Boiling point: | 114-115 °C/12 mmHg (lit.) |
| Density | 1.2600 |
| refractive index | 1.5130 (estimate) |
| Flash point: | 114-115°C/12mm |
| storage temp. | Store below +30°C. |
| form | Crystalline Powder |
| color | White to cream |
| Water Solubility | Hydrolyzes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 2212 |
| InChI | InChI=1S/C5H4O3/c1-3-2-4(6)8-5(3)7/h1-2H2 |
| InChIKey | OFNISBHGPNMTMS-UHFFFAOYSA-N |
| SMILES | O1C(=O)CC(=C)C1=O |
| CAS DataBase Reference | 2170-03-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Furandione, dihydro-3-methylene-(2170-03-8) |
| EPA Substance Registry System | 2,5-Furandione, dihydro-3-methylene- (2170-03-8) |
Description and Uses
Itaconic anhydride is used in immobilization of β-glucosidase. It undergoes estrification to obtain suitable monomers for emulsion polymerization itaconates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HS Code | 2917 19 80 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




