A5044912
<i>trans</i>-4-Methylcyclohexylamine , ≥98.0%(GC) , 2523-55-9
CAS NO.：2523-55-9
Empirical Formula: C7H15N
Molecular Weight: 113.2
MDL number: MFCD06411232
EINECS: 607-658-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB218.40 | In Stock |
|
| 25G | RMB621.60 | In Stock |
|
| 100g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -8.5°C (estimate) |
| Boiling point: | 151-154°C |
| Density | 0.85 |
| refractive index | 1.4500 to 1.4530 |
| Flash point: | 26°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | clear liquid |
| pka | 10.58±0.70(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H15N/c1-6-2-4-7(8)5-3-6/h6-7H,2-5,8H2,1H3/t6-,7- |
| InChIKey | KSMVBYPXNKCPAJ-LJGSYFOKSA-N |
| SMILES | [C@@H]1(N)CC[C@@H](C)CC1 |
| CAS DataBase Reference | 2523-55-9(CAS DataBase Reference) |
Description and Uses
trans-4-Methylcyclohexylamine is used to characterize spermidine synthase of malaria parasite.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P280-P210-P309+P311 |
| Hazard Codes | C,Xn |
| Risk Statements | 10-35-52-36-22 |
| Safety Statements | 16-28-26 |
| RIDADR | 2733 |
| HazardClass | 8/3 |
| PackingGroup | II |
| HS Code | 2921309990 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
