A5048412
2-<i>tert</i>-Butyl-1,4-benzoquinone , ≥98.0%(GC) , 3602-55-9
CAS NO.：3602-55-9
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD00666928
EINECS: 222-757-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-58 °C(lit.) |
| Boiling point: | 227.8±15.0 °C(Predicted) |
| Density | 1.092±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| form | Solid |
| color | Dark Yellow |
| InChI | InChI=1S/C10H12O2/c1-10(2,3)8-6-7(11)4-5-9(8)12/h4-6H,1-3H3 |
| InChIKey | NCCTVAJNFXYWTM-UHFFFAOYSA-N |
| SMILES | C1(=O)C=CC(=O)C=C1C(C)(C)C |
| CAS DataBase Reference | 3602-55-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Cyclohexadiene-1,4-dione, 2-(1,1-dimethylethyl)-(3602-55-9) |
Description and Uses
2-tert-Butyl-1,4-benzoquinone may be used in the synthesis of azatrioxa[8]circulene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DK3790000 |
| HS Code | 29146990 |
