A5048612
(<i>S</i>)-(+)-Phenylsuccinic Acid , 98% , 4036-30-0
CAS NO.：4036-30-0
Empirical Formula: C10H10O4
Molecular Weight: 194.18
MDL number: MFCD00065929
EINECS: 223-719-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB180.80 | In Stock |
|
| 1G | RMB407.20 | In Stock |
|
| 5G | RMB1084.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-176 °C |
| alpha | 168 º (c=1, acetone) |
| Boiling point: | 290.62°C (rough estimate) |
| Density | 1.2534 (rough estimate) |
| refractive index | 147.5 ° (C=2, EtOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | within almost transparency in Methanol |
| form | powder to crystal |
| pka | 3.60±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +171±4°, c = 1% in acetone |
| BRN | 2616723 |
| InChI | InChI=1S/C10H10O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14)/t8-/m0/s1 |
| InChIKey | LVFFZQQWIZURIO-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](C1=CC=CC=C1)CC(O)=O |
| CAS DataBase Reference | 4036-30-0(CAS DataBase Reference) |
Description and Uses
(S)-(+)-Phenylsuccinic acid is an enantiomer of (R)-Phenylsuccinic acid that has been used for the asymmetric synthesis of amines, antihistamines, and other compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 29171990 |
