PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 360.0±42.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | Solubility Insoluble in water; soluble in ethanol |
| form | powder |
| pka | 8.1, 9.4, 10.6(at 25℃) |
| color | Reddish-blue |
| PH Range | Red (6.3) to blue (12.3) |
| λmax | 602nm |
| BRN | 2095656 |
| Major Application | Liquid crystal display device, chemical-mechanical polishing, fuel cell, redox materials, hair dyes, lubricants, bacterial vaginosis screening technique, biosensor |
| InChI | 1S/C12H9NO2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,14H |
| InChIKey | RSAZYXZUJROYKR-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)N=C2C=CC(=O)C=C2 |
| CAS DataBase Reference | 500-85-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 4-[(4-hydroxyphenyl)imino]- (500-85-6) |
Description and Uses
Indophenol is an artificial blue metachromatic dye. The formation of Indophenol can be used to determine ammonia and paracetamol by spectrophotometry. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GU5778000 |
| HS Code | 2907199090 |
| Storage Class | 11 - Combustible Solids |



![3'-Chloroindophenol Sodium Salt [Redox Indicator]](https://img.chemicalbook.com/CAS/GIF/41350-02-1.gif)



