A5050912
trans-4-Hydroxy-D-proline , 97% , 3398-22-9
Synonym(s):
(2R,4S)-4-Hydroxypyrrolidine-2-carboxylic acid
CAS NO.：3398-22-9
Empirical Formula: C5H9NO3
Molecular Weight: 131.13
MDL number: MFCD00065608
EINECS: 625-221-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB110.40 | In Stock |
|
| 1G | RMB158.40 | In Stock |
|
| 5g | RMB692.00 | In Stock |
|
| 25g | RMB2806.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260°C |
| Boiling point: | 355.2±42.0 °C(Predicted) |
| Density | 1.395±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.14±0.40(Predicted) |
| form | powder |
| color | White to off-white |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m0/s1 |
| InChIKey | PMMYEEVYMWASQN-IUYQGCFVSA-N |
| SMILES | C(O)(=O)[C@H]1C[C@H](O)CN1 |
| CAS DataBase Reference | 3398-22-9(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H334-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 24/25-36/37-26 |
| WGK Germany | 3 |
| HS Code | 29339900 |
