A5051212
exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic Anhydride , ≥98.0% , 6118-51-0
CAS NO.:6118-51-0
Empirical Formula: C8H6O4
Molecular Weight: 166.13
MDL number: MFCD00151506
EINECS: 629-406-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB73.60 | In Stock |
|
| 100G | RMB254.40 | In Stock |
|
| 500G | RMB942.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118 °C (dec.)(lit.) |
| Boiling point: | 372.0±42.0 °C(Predicted) |
| Density | 1.540±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Hydrolyzes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 10355 |
| InChI | 1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ |
| InChIKey | QQYNRBAAQFZCLF-FBXFSONDSA-N |
| SMILES | O=C1OC(=O)[C@H]2C3OC(C=C3)[C@@H]12 |
| CAS DataBase Reference | 6118-51-0 |
Description and Uses
Intermediate in a useful synthesis of 4,4-dialkyl-2-butenolides, based on reaction with two moles of Grignard reagent, followed by cycloreversion (elimination of furan) to release the double bond.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | KC9650000 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![4,10-Dioxatricyclo[5.2.1.02,6]decan-8-en-3-one](https://img.chemicalbook.com/CAS/GIF/72150-22-2.gif)

