A5054112
<i>N</i>-Chlorophthalimide , ≥95.0% , 3481-09-2
CAS NO.:3481-09-2
Empirical Formula: C8H4ClNO2
Molecular Weight: 181.58
MDL number: MFCD00023027
EINECS: 222-459-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB46.40 | In Stock |
|
| 25G | RMB131.20 | In Stock |
|
| 100G | RMB375.20 | In Stock |
|
| 500G | RMB1543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-198 °C (lit.) |
| Boiling point: | 315.1±25.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -3.53±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H4ClNO2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H |
| InChIKey | WDRFYIPWHMGQPN-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1Cl |
| CAS DataBase Reference | 3481-09-2(CAS DataBase Reference) |
Description and Uses
N-Chlorophthalimide may be employed in the synthesis of:
- α-amino acetal
- α-amino nitro compounds
- vicinal diamine
- α,β-unsaturated vicinal haloamino nitro compound
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1759 |
| WGK Germany | 1 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




