A5057112
N-Carbobenzoxy-D-serine , ≥98.0% , 6081-61-4
CAS NO.:6081-61-4
Empirical Formula: C11H13NO5
Molecular Weight: 239.22
MDL number: MFCD00063144
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB469.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-119°C |
| Boiling point: | 487.5±45.0 °C(Predicted) |
| Density | 1.354±0.06 g/cm3(Predicted) |
| refractive index | -6 ° (C=6, AcOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetic Acid (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.60±0.10(Predicted) |
| color | Off-White |
| BRN | 2058313 |
| InChI | InChI=1S/C11H13NO5/c13-6-9(10(14)15)12-11(16)17-7-8-4-2-1-3-5-8/h1-5,9,13H,6-7H2,(H,12,16)(H,14,15)/t9-/m1/s1 |
| InChIKey | GNIDSOFZAKMQAO-SECBINFHSA-N |
| SMILES | C(O)(=O)[C@@H](CO)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 6081-61-4(CAS DataBase Reference) |
Description and Uses
N-Benzyloxycarbonyl-D-serine is D-serine (S270975) with amine protected from eletrophiles by carboxybenzyl group in organic synthesis. N-Benzyloxycarbonyl-D-serine can be used to synthesize acetamido-methoxypropionamides such as Desacetyl Desmethyl Lacosamide (D288325) which is a potent anticonvulsant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| HS Code | 2924297099 |







