A5061112
3-Isopropylphenol , ≥98.0%(GC) , 618-45-1
CAS NO.:618-45-1
Empirical Formula: C9H12O
Molecular Weight: 136.19
MDL number: MFCD00002301
EINECS: 210-551-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25 °C(lit.) |
| Boiling point: | 228 °C(lit.) |
| Density | 0.994 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 220 °F |
| storage temp. | -20°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Sparingly) |
| form | liquid |
| pka | 10.03±0.10(Predicted) |
| color | white to brown |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C9H12O/c1-7(2)8-4-3-5-9(10)6-8/h3-7,10H,1-2H3 |
| InChIKey | VLJSLTNSFSOYQR-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(C(C)C)=C1 |
| LogP | 2.851 (est) |
| CAS DataBase Reference | 618-45-1(CAS DataBase Reference) |
| EPA Substance Registry System | m-Isopropylphenol (618-45-1) |
Description and Uses
3-Isopropylphenol is an impurity of Propofol (P829750).
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xn |
| Risk Statements | 22-34 |
| Safety Statements | 26-28-36/37/39-45-27 |
| RIDADR | UN 2430 8/PG 2 |
| WGK Germany | 3 |
| RTECS | SL5800000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2907199090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








