A5061712
<i>N</i>-Ethylcarbazole-3-carboxaldehyde , ≥98.0%(GC) , 7570-45-8
CAS NO.：7570-45-8
Empirical Formula: C15H13NO
Molecular Weight: 223.27
MDL number: MFCD00004963
EINECS: 231-471-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB97.60 | In Stock |
|
| 25G | RMB398.40 | In Stock |
|
| 100G | RMB1335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C (lit.) |
| Boiling point: | 255 °C / 15mmHg |
| Density | 1.0707 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Benzene,Toluene |
| form | Crystalline Powder or Granules |
| color | Yellow to ochre |
| InChI | 1S/C15H13NO/c1-2-16-14-6-4-3-5-12(14)13-9-11(10-17)7-8-15(13)16/h3-10H,2H2,1H3 |
| InChIKey | QGJXVBICNCIWEL-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc2n(CC)c3ccccc3c2c1 |
| CAS DataBase Reference | 7570-45-8(CAS DataBase Reference) |
Description and Uses
9-Ethyl-3-carbazolecarboxaldehyde was used in the synthesis of poly(vinyl acetal)s (PVAcs).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
