A5063812
<i>N</i>-(4-Bromobutyl)phthalimide , 98% , 5394-18-3
CAS NO.:5394-18-3
Empirical Formula: C12H12BrNO2
Molecular Weight: 282.13
MDL number: MFCD00005905
EINECS: 226-401-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-80 °C (lit.) |
| Boiling point: | 165-170°C 1mm |
| Density | 1.5271 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| Flash point: | 165-170°C/1mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -2.15±0.20(Predicted) |
| form | Powder |
| color | White to light brown |
| Water Solubility | Soluble in ethanol. Insoluble in water. |
| BRN | 164119 |
| InChI | 1S/C12H12BrNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | UXFWTIGUWHJKDD-UHFFFAOYSA-N |
| SMILES | O=C1N(CCCCBr)C(C2=CC=CC=C21)=O |
| CAS DataBase Reference | 5394-18-3(CAS DataBase Reference) |
| NIST Chemistry Reference | N-(4-bromobutyl)phthalimide(5394-18-3) |
Description and Uses
N-(4-Bromobutyl)phthalimide is used in organic synthesis and the production of pharmaceutical. It can react with 1-phenyl-piperazine to get N-[4-(4-phenyl-piperazin-1-yl)-butyl]-phthalimide. It is a useful synthesis reagent used to synthesize B-cyclodextrin derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H341 |
| Precautionary statements | P201-P202-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P308+P313-P405-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29251995 |
| Storage Class | 11 - Combustible Solids |








