A5064812
Fmoc-D-Pip-OH , ≥98.0% , 101555-63-9
Synonym(s):
(R)-N-Fmoc-piperidine-2-carboxylic acid;N-Fmoc-D -pipecolic acid;Fmoc-D -pipecolic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB41.04 | In Stock |
|
| 1G | RMB114.48 | In Stock |
|
| 5G | RMB402.48 | In Stock |
|
| 10g | RMB519.20 | In Stock |
|
| 25g | RMB972.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-153°C |
| Boiling point: | 561.6±43.0 °C(Predicted) |
| Density | 1.293±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 3.97±0.20(Predicted) |
| color | White to pale brown |
| optical activity | 20.768°(C=0.01g/ml DMF) |
| BRN | 5485101 |
| Major Application | peptide synthesis |
| InChI | 1S/C21H21NO4/c23-20(24)19-11-5-6-12-22(19)21(25)26-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18-19H,5-6,11-13H2,(H,23,24)/t19-/m1/s1 |
| InChIKey | CKLAZLINARHOTG-LJQANCHMSA-N |
| SMILES | OC(=O)[C@H]1CCCCN1C(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 101555-63-9(CAS DataBase Reference) |
Description and Uses
(R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidine-2-carboxylic Acid is a building block used as a reactant in the preparation cyclic tetrapeptide derivatives as histone deacetylase inhibitors and antitumor agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
