PRODUCT Properties
| Melting point: | 184 °C |
| Boiling point: | 322.5±25.0 °C(Predicted) |
| Density | 1.897±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 15.46±0.50(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H6INO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10) |
| InChIKey | YEOYYWCXWUDVCX-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C1=CC=CC=C1I |
Description and Uses
2-Iodobenzamide is a solvent that is used to produce amides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| RTECS | CV5399625 |
| HS Code | 2924297099 |
