A5093412
3-Iodo-<i>p</i>-toluic Acid , >98.0% , 82998-57-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.96 | In Stock |
|
| 10g | RMB70.40 | In Stock |
|
| 25G | RMB174.96 | In Stock |
|
| 100g | RMB575.28 | In Stock |
|
| 500g | RMB2440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212 °C (lit.) |
| Boiling point: | 278.5°C (rough estimate) |
| Density | 1.7835 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | Solid |
| pka | 4.02±0.10(Predicted) |
| color | Off-White |
| Sensitive | Light Sensitive |
| BRN | 2436216 |
| InChI | InChI=1S/C8H7IO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | LDDHMKANNXWUAK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C)C(I)=C1 |
| CAS DataBase Reference | 82998-57-0(CAS DataBase Reference) |
Description and Uses
3-Iodo-4-methylbenzoic acid has been used in the preparation of unlabeled N-succinimidyl 4-guanidinomethyl-3-iodobenzoate (SGIMB) and boc-protected derivative of SGIMB (Boc-SGMIB).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






