A5096412
Isonicotinic Acid <i>N</i>-Oxide , >98.0%(HPLC) , 13602-12-5
CAS NO.：13602-12-5
Empirical Formula: C6H5NO3
Molecular Weight: 139.11
MDL number: MFCD00006209
EINECS: 237-086-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB206.40 | In Stock |
|
| 50g | RMB559.20 | In Stock |
|
| 100G | RMB569.60 | In Stock |
|
| 250G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-271 °C(lit.) |
| Boiling point: | 255.04°C (rough estimate) |
| Density | 1.4429 (rough estimate) |
| refractive index | 1.5423 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.66±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light red |
| BRN | 119571 |
| InChI | InChI=1S/C6H5NO3/c8-6(9)5-1-3-7(10)4-2-5/h1-4H,(H,8,9) |
| InChIKey | QCWTWMJMLSKQCJ-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C(C(O)=O)C=1 |
| LogP | -1.520 (est) |
| CAS DataBase Reference | 13602-12-5(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Pyridinecarboxylic acid 1-oxide (13602-12-5) |
Description and Uses
Isonicotinic acid N-oxide was used in the synthesis of three-dimensional coordination polymers based on inorganic lanthanide(II) sulfate skeletons.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2933399990 |
