A5110512
1-(<I>N</I>-<WBR>Boc-<WBR>aminomethyl)<WBR>-<WBR>4-<WBR>(aminomethyl)<WBR>benzene , 95% , 108468-00-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB167.20 | In Stock |
|
| 5G | RMB521.60 | In Stock |
|
| 10g | RMB922.40 | In Stock |
|
| 25g | RMB1809.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-68 °C (lit.) |
| Boiling point: | 250 °C(lit.) |
| Density | 1.06 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 12.29±0.46(Predicted) |
| color | White to slightly yellow-pink or beige |
| InChI | 1S/C13H20N2O2/c1-13(2,3)17-12(16)15-9-11-6-4-10(8-14)5-7-11/h4-7H,8-9,14H2,1-3H3,(H,15,16) |
| InChIKey | NUANLVJLUYWSER-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CN)cc1 |
Description and Uses
1-(N-Boc-aminomethyl)-4-(aminomethyl)benzene may be used for the synthesis of:
- oligomeric thioureas
- bipyrrole-based[2]catenane
- model receptors for dicarboxylates and monosaccharides
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29215990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



