A5110812
(<I>S</I>)-(−)-1,1,2-Triphenyl-1,2-ethanediol , 98% , 108998-83-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB135.20 | In Stock |
|
| 5G | RMB428.00 | In Stock |
|
| 10g | RMB655.20 | In Stock |
|
| 25g | RMB1607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-127 °C (lit.) |
| Boiling point: | 452.3±40.0 °C(Predicted) |
| alpha | -214 º (C=1 IN ETOH) |
| Density | 1.196±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.87±0.29(Predicted) |
| form | Powder |
| color | Pale brown |
| optical activity | [α]20/D 214°, c = 1 in ethanol |
| BRN | 3208922 |
| InChI | InChI=1S/C20H18O2/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19,21-22H/t19-/m0/s1 |
| InChIKey | GWVWUZJOQHWMFB-IBGZPJMESA-N |
| SMILES | C(C1=CC=CC=C1)(C1=CC=CC=C1)(O)[C@H](C1=CC=CC=C1)O |
| CAS DataBase Reference | 108998-83-0(CAS DataBase Reference) |
Description and Uses
It is used as pharmaceutical and fine chemical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29062990 |
