A5115012
<I>N</I>-Methyl-<I>N</I>-<WBR>(2-<WBR>hydroxyethyl)<WBR>-<WBR>4-<WBR>aminobenzaldehyde , 96% , 1201-91-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB72.00 | In Stock |
|
| 5g | RMB247.20 | In Stock |
|
| 25G | RMB844.00 | In Stock |
|
| 100g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-70 °C(lit.) |
| Boiling point: | 354.0±27.0 °C(Predicted) |
| Density | 1.170±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.58±0.10(Predicted) |
| color | Brown to Dark Brown |
| InChI | InChI=1S/C10H13NO2/c1-11(6-7-12)10-4-2-9(8-13)3-5-10/h2-5,8,12H,6-7H2,1H3 |
| InChIKey | JOCUIVLSLBBESN-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(N(CCO)C)C=C1 |
| CAS DataBase Reference | 1201-91-8(CAS DataBase Reference) |
Description and Uses
N-Methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde may be used to synthesize:
- 2,5-bis[4-(methylaminoethanol)benzylidene]cyclopentanone
- 4′-[(2-tosyloxyethyl)(methyl)amino]-4-phenyl-3-buten-2-malonitrile, a tosylate precursor
- methanesulfonic acid 2-[(4-formyl-phenyl)-methyl-amino]-ethyl ester
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922500090 |






