A5132812
<I>cis</I>-3-Hexenyl butyrate , 98% , 16491-36-4
CAS NO.:16491-36-4
Empirical Formula: C10H18O2
Molecular Weight: 170.25
MDL number: MFCD00036540
EINECS: 240-553-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB287.20 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| 1KG | RMB1759.20 | In Stock |
|
| 500G | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 96 °C20 mm Hg(lit.) |
| Density | 0.885 g/mL at 25 °C(lit.) |
| FEMA | 3402 | CIS-3-HEXENYL BUTYRATE |
| refractive index | n |
| Flash point: | 174 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| Specific Gravity | 0.885 |
| Odor | at 100.00 %. fresh green apple fruity wine metallic buttery |
| Appearance | Colorless to light yellow Liquid |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 157 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18O2/c1-3-5-6-7-9-12-10(11)8-4-2/h5-6H,3-4,7-9H2,1-2H3/b6-5- |
| InChIKey | ZCHOPXVYTWUHDS-WAYWQWQTSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)CCC |
| LogP | 3.48 |
| CAS DataBase Reference | 16491-36-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanoic acid, 3-hexenyl ester, (z)-(16491-36-4) |
| EPA Substance Registry System | (Z)-3-Hexenyl butyrate (16491-36-4) |
Description and Uses
cis-3-Hexenyl butyrate has a green, fruity, somewhat buttery aroma. May be synthesized by esterification of cis-3-hexenol with n-butyric acid under azeotropic conditions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







