A5141212
<I>tert</I>-Butyl 4-<WBR>acetylpiperidine-<WBR>1-<WBR>carboxylate , 95% , 206989-61-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.00 | In Stock |
|
| 1G | RMB51.20 | In Stock |
|
| 5g | RMB158.40 | In Stock |
|
| 10g | RMB224.80 | In Stock |
|
| 25g | RMB508.00 | In Stock |
|
| 100g | RMB1560.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 312.4±35.0 °C(Predicted) |
| Density | 1.052±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -2.23±0.40(Predicted) |
| form | solid |
| Appearance | Colorless to off-white Liquid |
| InChI | InChI=1S/C12H21NO3/c1-9(14)10-5-7-13(8-6-10)11(15)16-12(2,3)4/h10H,5-8H2,1-4H3 |
| InChIKey | HNVBBNZWMSTMAZ-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(C(C)=O)CC1 |
Description and Uses
tert-Butyl 4-Acetylpiperidine-1-carboxylate is a useful research chemical.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |






![tert-butyl 4-(3-cyano-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl)piperidine-1-carboxylate](https://img.chemicalbook.com/CAS/20200331/GIF/2190506-56-8.gif)
