A5142512
<I>N</I>-Boc-indole-2-boronic acid , 95% , 213318-44-6
Synonym(s):
N-(tert-butoxycarbonyl)indole-2-boronic acid;1-(tert-butoxycarbonyl)indole-2-boronic acid
CAS NO.:213318-44-6
Empirical Formula: C13H16BNO4
Molecular Weight: 261.08
MDL number: MFCD02093045
EINECS: 681-628-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1G | RMB107.20 | In Stock |
|
| 5G | RMB363.20 | In Stock |
|
| 25g | RMB1315.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-94 °C
85-90 °C (lit.) |
| Boiling point: | 443.5±55.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | powder to crystal |
| pka | 8.12±0.30(Predicted) |
| color | White to Orange to Green |
| BRN | 8148683 |
| InChI | 1S/C13H16BNO4/c1-13(2,3)19-12(16)15-10-7-5-4-6-9(10)8-11(15)14(17)18/h4-8,17-18H,1-3H3 |
| InChIKey | SVIBPSNFXYUOFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1c(cc2ccccc12)B(O)O |
| CAS DataBase Reference | 213318-44-6(CAS DataBase Reference) |
Description and Uses
Reactant involved in:
- Suzuki-Miyaura cross-coupling reactions
- Copper-catalyzed trifluoromethylation
- Palladium-catalyzed benzylation
- Homocoupling reactions
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H228 |
| Precautionary statements | P210-P240-P241-P280-P370+P378 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| Hazard Note | IrritantKeep Cold |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 2 |






