A5152712
(<I>S</I>)-(+)-α-Aminocyclohexanepropionic acid hydrate , 95% , 307310-72-1
Synonym(s):
3-Cyclohexyl-L -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25g | RMB239.20 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234-237 °C (lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| Appearance | White to off-white Solid |
| optical activity | [α]21/D +12.0°, c = 1 in 1 M NaOH |
| Major Application | peptide synthesis |
| InChI | 1S/C9H17NO2.H2O/c10-8(9(11)12)6-7-4-2-1-3-5-7;/h7-8H,1-6,10H2,(H,11,12);1H2/t8-;/m0./s1 |
| InChIKey | HDJQIWAIDCEDEF-QRPNPIFTSA-N |
| SMILES | [H]O[H].N[C@@H](CC1CCCCC1)C(O)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
