A5159112
(<I>R</I>)-3,3′-Bis(9-anthracenyl)-1,1′-binaphthyl-2,2′-diyl hydrogenphosphate , 95% , 361342-51-0
Synonym(s):
(11bR)-2,6-Di-9-anthracenyl-4-hydroxy-dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-oxide
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB491.20 | In Stock |
|
| 100MG | RMB669.60 | In Stock |
|
| 500MG | RMB2687.20 | In Stock |
|
| 1g | RMB4549.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 288-292 °C (D) |
| Density | 1.46±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | 1.11±0.20(Predicted) |
| form | solid |
| Appearance | White to light yellow Solid |
| InChIKey | QYJHYRSRVCOHMY-UHFFFAOYSA-N |
| SMILES | O1C2=C(C3C4=CC=CC=C4C=C4C=3C=CC=C4)C=C3C(=C2C2=C4C(C=CC=C4)=CC(C4C5=CC=CC=C5C=C5C=4C=CC=C5)=C2OP1(=O)O)C=CC=C3 |
Description and Uses
Catalyst used in asymmetric direct alkylation of α-diazoester via C-H bond cleavage.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29199000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![(11bR)-2,6-Bis(4-(tert-butyl)phenyl)-4-hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine4-oxide](https://img.chemicalbook.com/CAS/20180808/GIF/861909-30-0.gif)
![(11bS)-4-Hydroxy-2,6-bis(4-nitrophenyl)dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine4-oxide](https://img.chemicalbook.com/CAS/GIF/878111-16-1.gif)

