A5168612
<I>trans</I>-4-Methoxy-β-nitrostyrene , 99% , 5576-97-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB224.80 | In Stock |
|
| 25g | RMB735.20 | In Stock |
|
| 100g | RMB1960.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88 °C(lit.) |
| Boiling point: | 317.0±17.0 °C(Predicted) |
| Density | 1.189±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: soluble25mg/mL, clear, yellow |
| Appearance | Light yellow to yellow Solid |
| BRN | 2047935 |
| InChI | 1S/C9H9NO3/c1-13-9-4-2-8(3-5-9)6-7-10(11)12/h2-7H,1H3/b7-6+ |
| InChIKey | JKQUXSHVQGBODD-VOTSOKGWSA-N |
| SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1ccc(OC)cc1 |
| CAS DataBase Reference | 5576-97-6 |
Description and Uses
trans-4-Methoxy-β-nitrostyrene acts as guest molecule and forms guest molecules forming co-crystal phases with the d-form of robust syndiotactic polystyrene (sPS). It may be employed as a Michael acceptor in the synthesis of proline based chiral ionic liquid catalysts with two five-membered unsaturated aza-heterocycles.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![1-(BENZYLOXY)-2-METHOXY-4-[(E)-2-NITROETHENYL]BENZENE](https://img.chemicalbook.com/CAS/GIF/1860-56-6.gif)
